C11H21N — CID 102173535
(4S,4aS,8aS)-4,7-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline (PubChem CID 102173535) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is (4S,4aS,8aS)-4,7-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline.
| Compound Name | (4S,4aS,8aS)-4,7-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline |
|---|---|
| PubChem CID | 102173535 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | (4S,4aS,8aS)-4,7-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline |
| SMILES | CC1CC[C@@H]2[C@H](C1)NCC[C@@H]2C |
| InChI | InChI=1S/C11H21N/c1-8-3-4-10-9(2)5-6-12-11(10)7-8/h8-12H,3-7H2,1-2H3/t8?,9-,10-,11-/m0/s1 |
| InChIKey | KALWKFWAIFTWEW-KQFSYOIOSA-N |
| XLogP | 2.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |