C16H26O4 — CID 141010947
1-[[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl 2-methylprop-2-enoate (PubChem CID 141010947) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is 1-[[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 1-[[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 141010947 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 1-[[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)O[C@]1(O)C[C@H]2CC[C@]1(C)C2(C)C |
| InChI | InChI=1S/C16H26O4/c1-10(2)13(17)19-11(3)20-16(18)9-12-7-8-15(16,6)14(12,4)5/h11-12,18H,1,7-9H2,2-6H3/t11?,12-,15-,16-/m1/s1 |
| InChIKey | LVNUODZUZHWDKH-JHHHBPTKSA-N |
| XLogP | 3.00 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|