C16H28O2 — CID 146210315
1-(2,2,3,3-tetramethylcyclopentyl)propan-2-yl 2-methylprop-2-enoate (PubChem CID 146210315) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is 1-(2,2,3,3-tetramethylcyclopentyl)propan-2-yl 2-methylprop-2-enoate.
| Compound Name | 1-(2,2,3,3-tetramethylcyclopentyl)propan-2-yl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 146210315 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | 1-(2,2,3,3-tetramethylcyclopentyl)propan-2-yl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)CC1CCC(C)(C)C1(C)C |
| InChI | InChI=1S/C16H28O2/c1-11(2)14(17)18-12(3)10-13-8-9-15(4,5)16(13,6)7/h12-13H,1,8-10H2,2-7H3 |
| InChIKey | LWAPNWMFKIZMLV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|