C16H24O6 — CID 140668581
4-methyl-1-[2-(2-methylprop-2-enoyloxy)propyl]cyclohexane-1,2-dicarboxylic acid (PubChem CID 140668581) has the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol. Its IUPAC name is 4-methyl-1-[2-(2-methylprop-2-enoyloxy)propyl]cyclohexane-1,2-dicarboxylic acid.
| Compound Name | 4-methyl-1-[2-(2-methylprop-2-enoyloxy)propyl]cyclohexane-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 140668581 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 4-methyl-1-[2-(2-methylprop-2-enoyloxy)propyl]cyclohexane-1,2-dicarboxylic acid |
| SMILES | C=C(C)C(=O)OC(C)CC1(C(=O)O)CCC(C)CC1C(=O)O |
| InChI | InChI=1S/C16H24O6/c1-9(2)14(19)22-11(4)8-16(15(20)21)6-5-10(3)7-12(16)13(17)18/h10-12H,1,5-8H2,2-4H3,(H,17,18)(H,20,21) |
| InChIKey | ZEAOIROHVXKQEJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|