C21H36N2O3 — CID 131968708
1-(2,2,3,3-tetramethylcyclopentyl)propan-2-yl 1-(2-methyliminopropanoyl)pyrrolidine-2-carboxylate (PubChem CID 131968708) has the molecular formula C21H36N2O3 and a molecular weight of 364.53 g/mol. Its IUPAC name is 1-(2,2,3,3-tetramethylcyclopentyl)propan-2-yl 1-(2-methyliminopropanoyl)pyrrolidine-2-carboxylate.
| Compound Name | 1-(2,2,3,3-tetramethylcyclopentyl)propan-2-yl 1-(2-methyliminopropanoyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 131968708 |
| Molecular Formula | C21H36N2O3 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.27 |
| IUPAC Name | 1-(2,2,3,3-tetramethylcyclopentyl)propan-2-yl 1-(2-methyliminopropanoyl)pyrrolidine-2-carboxylate |
| SMILES | C/N=C(\C)C(=O)N1CCCC1C(=O)OC(C)CC1CCC(C)(C)C1(C)C |
| InChI | InChI=1S/C21H36N2O3/c1-14(13-16-10-11-20(3,4)21(16,5)6)26-19(25)17-9-8-12-23(17)18(24)15(2)22-7/h14,16-17H,8-13H2,1-7H3/b22-15+ |
| InChIKey | UDADQNPHGGXWDC-PXLXIMEGSA-N |
| XLogP | 3.85 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|