C12H19NO5 — CID 145029802
[(2S)-4-methoxy-4-oxobutan-2-yl] 1-acetylpyrrolidine-2-carboxylate (PubChem CID 145029802) has the molecular formula C12H19NO5 and a molecular weight of 257.29 g/mol. Its IUPAC name is [(2S)-4-methoxy-4-oxobutan-2-yl] 1-acetylpyrrolidine-2-carboxylate.
| Compound Name | [(2S)-4-methoxy-4-oxobutan-2-yl] 1-acetylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 145029802 |
| Molecular Formula | C12H19NO5 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | [(2S)-4-methoxy-4-oxobutan-2-yl] 1-acetylpyrrolidine-2-carboxylate |
| SMILES | COC(=O)C[C@H](C)OC(=O)C1CCCN1C(C)=O |
| InChI | InChI=1S/C12H19NO5/c1-8(7-11(15)17-3)18-12(16)10-5-4-6-13(10)9(2)14/h8,10H,4-7H2,1-3H3/t8-,10?/m0/s1 |
| InChIKey | DPVLLBMLHSJXEH-PEHGTWAWSA-N |
| XLogP | 0.49 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |