C20H26N2O7 — CID 118934174
[(2R,3S)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butan-2-yl] (2S)-1-acetylpyrrolidine-2-carboxylate (PubChem CID 118934174) has the molecular formula C20H26N2O7 and a molecular weight of 406.44 g/mol. Its IUPAC name is [(2R,3S)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butan-2-yl] (2S)-1-acetylpyrrolidine-2-carboxylate.
| Compound Name | [(2R,3S)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butan-2-yl] (2S)-1-acetylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 118934174 |
| Molecular Formula | C20H26N2O7 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | [(2R,3S)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butan-2-yl] (2S)-1-acetylpyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H](NC(=O)OCc1ccccc1)[C@@H](C)OC(=O)[C@@H]1CCCN1C(C)=O |
| InChI | InChI=1S/C20H26N2O7/c1-13(29-18(24)16-10-7-11-22(16)14(2)23)17(19(25)27-3)21-20(26)28-12-15-8-5-4-6-9-15/h4-6,8-9,13,16-17H,7,10-12H2,1-3H3,(H,21,26)/t13-,16+,17+/m1/s1 |
| InChIKey | WTMXTJHHIOLKJV-COXVUDFISA-N |
| XLogP | 1.40 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|