C18H23NO4 — CID 168869008
methyl 3,3-dicyclopropyl-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 168869008) has the molecular formula C18H23NO4 and a molecular weight of 317.38 g/mol. Its IUPAC name is methyl 3,3-dicyclopropyl-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | methyl 3,3-dicyclopropyl-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 168869008 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | methyl 3,3-dicyclopropyl-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | COC(=O)C(NC(=O)OCc1ccccc1)C(C1CC1)C1CC1 |
| InChI | InChI=1S/C18H23NO4/c1-22-17(20)16(15(13-7-8-13)14-9-10-14)19-18(21)23-11-12-5-3-2-4-6-12/h2-6,13-16H,7-11H2,1H3,(H,19,21) |
| InChIKey | OBDIVABPOKIWTD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |