C20H25NO6 — CID 102123553
dimethyl (2R,3S)-2-cyclohex-2-en-1-yl-3-(phenylmethoxycarbonylamino)butanedioate (PubChem CID 102123553) has the molecular formula C20H25NO6 and a molecular weight of 375.42 g/mol. Its IUPAC name is dimethyl (2R,3S)-2-cyclohex-2-en-1-yl-3-(phenylmethoxycarbonylamino)butanedioate.
| Compound Name | dimethyl (2R,3S)-2-cyclohex-2-en-1-yl-3-(phenylmethoxycarbonylamino)butanedioate |
|---|---|
| PubChem CID | 102123553 |
| Molecular Formula | C20H25NO6 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | dimethyl (2R,3S)-2-cyclohex-2-en-1-yl-3-(phenylmethoxycarbonylamino)butanedioate |
| SMILES | COC(=O)[C@@H](NC(=O)OCc1ccccc1)[C@H](C(=O)OC)C1C=CCCC1 |
| InChI | InChI=1S/C20H25NO6/c1-25-18(22)16(15-11-7-4-8-12-15)17(19(23)26-2)21-20(24)27-13-14-9-5-3-6-10-14/h3,5-7,9-11,15-17H,4,8,12-13H2,1-2H3,(H,21,24)/t15?,16-,17+/m1/s1 |
| InChIKey | JYJAGEIRNROUGX-FGJGXXMFSA-N |
| XLogP | 2.60 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|