C17H23NO5 — CID 169233741
methyl (2S)-2-cyclopentyloxy-3-(phenylmethoxycarbonylamino)propanoate (PubChem CID 169233741) has the molecular formula C17H23NO5 and a molecular weight of 321.37 g/mol. Its IUPAC name is methyl (2S)-2-cyclopentyloxy-3-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | methyl (2S)-2-cyclopentyloxy-3-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 169233741 |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | methyl (2S)-2-cyclopentyloxy-3-(phenylmethoxycarbonylamino)propanoate |
| SMILES | COC(=O)[C@H](CNC(=O)OCc1ccccc1)OC1CCCC1 |
| InChI | InChI=1S/C17H23NO5/c1-21-16(19)15(23-14-9-5-6-10-14)11-18-17(20)22-12-13-7-3-2-4-8-13/h2-4,7-8,14-15H,5-6,9-12H2,1H3,(H,18,20)/t15-/m0/s1 |
| InChIKey | AVMUCPMKWCRNBT-HNNXBMFYSA-N |
| XLogP | 2.41 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |