C20H27NO4S — CID 171775292
benzyl N-[(2S)-1,1-dicyclopropyl-4-[dimethyl(oxo)-λ6-sulfanylidene]-3-oxobutan-2-yl]carbamate (PubChem CID 171775292) has the molecular formula C20H27NO4S and a molecular weight of 377.51 g/mol. Its IUPAC name is benzyl N-[(2S)-1,1-dicyclopropyl-4-[dimethyl(oxo)-λ6-sulfanylidene]-3-oxobutan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1,1-dicyclopropyl-4-[dimethyl(oxo)-λ6-sulfanylidene]-3-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 171775292 |
| Molecular Formula | C20H27NO4S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | benzyl N-[(2S)-1,1-dicyclopropyl-4-[dimethyl(oxo)-λ6-sulfanylidene]-3-oxobutan-2-yl]carbamate |
| SMILES | CS(C)(=O)=CC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C1CC1)C1CC1 |
| InChI | InChI=1S/C20H27NO4S/c1-26(2,24)13-17(22)19(18(15-8-9-15)16-10-11-16)21-20(23)25-12-14-6-4-3-5-7-14/h3-7,13,15-16,18-19H,8-12H2,1-2H3,(H,21,23)/t19-/m1/s1 |
| InChIKey | WVKMXTRCTJCNTM-LJQANCHMSA-N |
| XLogP | 2.63 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|