C14H17NO6S — CID 58363617
(2S)-3-cyclopropyl-1-oxo-2-(phenylmethoxycarbonylamino)propane-1-sulfonic acid (PubChem CID 58363617) has the molecular formula C14H17NO6S and a molecular weight of 327.36 g/mol. Its IUPAC name is (2S)-3-cyclopropyl-1-oxo-2-(phenylmethoxycarbonylamino)propane-1-sulfonic acid.
| Compound Name | (2S)-3-cyclopropyl-1-oxo-2-(phenylmethoxycarbonylamino)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 58363617 |
| Molecular Formula | C14H17NO6S |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | (2S)-3-cyclopropyl-1-oxo-2-(phenylmethoxycarbonylamino)propane-1-sulfonic acid |
| SMILES | O=C(N[C@@H](CC1CC1)C(=O)S(=O)(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C14H17NO6S/c16-13(22(18,19)20)12(8-10-6-7-10)15-14(17)21-9-11-4-2-1-3-5-11/h1-5,10,12H,6-9H2,(H,15,17)(H,18,19,20)/t12-/m0/s1 |
| InChIKey | QSNMABNJTWQSSE-LBPRGKRZSA-N |
| XLogP | 1.50 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|