C8H12F3NO7S — CID 139768368
(2,2-dimethyl-5-nitro-1,3-dioxan-5-yl)methyl trifluoromethanesulfonate (PubChem CID 139768368) has the molecular formula C8H12F3NO7S and a molecular weight of 323.25 g/mol. Its IUPAC name is (2,2-dimethyl-5-nitro-1,3-dioxan-5-yl)methyl trifluoromethanesulfonate.
| Compound Name | (2,2-dimethyl-5-nitro-1,3-dioxan-5-yl)methyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139768368 |
| Molecular Formula | C8H12F3NO7S |
| Molecular Weight | 323.25 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | (2,2-dimethyl-5-nitro-1,3-dioxan-5-yl)methyl trifluoromethanesulfonate |
| SMILES | CC1(C)OCC(COS(=O)(=O)C(F)(F)F)([N+](=O)[O-])CO1 |
| InChI | InChI=1S/C8H12F3NO7S/c1-6(2)17-3-7(4-18-6,12(13)14)5-19-20(15,16)8(9,10)11/h3-5H2,1-2H3 |
| InChIKey | QDVWTJFYDXLCDK-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.25 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|