C17H23NO6 — CID 86200702
5-[(4-but-3-enoxyphenoxy)methyl]-2,2-dimethyl-5-nitro-1,3-dioxane (PubChem CID 86200702) has the molecular formula C17H23NO6 and a molecular weight of 337.37 g/mol. Its IUPAC name is 5-[(4-but-3-enoxyphenoxy)methyl]-2,2-dimethyl-5-nitro-1,3-dioxane.
| Compound Name | 5-[(4-but-3-enoxyphenoxy)methyl]-2,2-dimethyl-5-nitro-1,3-dioxane |
|---|---|
| PubChem CID | 86200702 |
| Molecular Formula | C17H23NO6 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 5-[(4-but-3-enoxyphenoxy)methyl]-2,2-dimethyl-5-nitro-1,3-dioxane |
| SMILES | C=CCCOc1ccc(OCC2([N+](=O)[O-])COC(C)(C)OC2)cc1 |
| InChI | InChI=1S/C17H23NO6/c1-4-5-10-21-14-6-8-15(9-7-14)22-11-17(18(19)20)12-23-16(2,3)24-13-17/h4,6-9H,1,5,10-13H2,2-3H3 |
| InChIKey | HMCOOKZRHKEIGA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|