C22H35NO4 — CID 56968060
2,2-dimethyl-5-nitro-5-[2-(4-octylphenyl)ethyl]-1,3-dioxane (PubChem CID 56968060) has the molecular formula C22H35NO4 and a molecular weight of 377.53 g/mol. Its IUPAC name is 2,2-dimethyl-5-nitro-5-[2-(4-octylphenyl)ethyl]-1,3-dioxane.
| Compound Name | 2,2-dimethyl-5-nitro-5-[2-(4-octylphenyl)ethyl]-1,3-dioxane |
|---|---|
| PubChem CID | 56968060 |
| Molecular Formula | C22H35NO4 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.26 |
| IUPAC Name | 2,2-dimethyl-5-nitro-5-[2-(4-octylphenyl)ethyl]-1,3-dioxane |
| SMILES | CCCCCCCCc1ccc(CCC2([N+](=O)[O-])COC(C)(C)OC2)cc1 |
| InChI | InChI=1S/C22H35NO4/c1-4-5-6-7-8-9-10-19-11-13-20(14-12-19)15-16-22(23(24)25)17-26-21(2,3)27-18-22/h11-14H,4-10,15-18H2,1-3H3 |
| InChIKey | ZBQQGCDODWOPEO-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|