About [(3S,5S)-3-nitro-5-(4-octylphenyl)oxolan-3-yl]methanol
[(3S,5S)-3-nitro-5-(4-octylphenyl)oxolan-3-yl]methanol (PubChem CID 124562659) has the molecular formula C19H29NO4
and a molecular weight of 335.44 g/mol. Its IUPAC name is [(3S,5S)-3-nitro-5-(4-octylphenyl)oxolan-3-yl]methanol.
Molecular Properties
| Compound Name | [(3S,5S)-3-nitro-5-(4-octylphenyl)oxolan-3-yl]methanol |
| PubChem CID | 124562659 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | [(3S,5S)-3-nitro-5-(4-octylphenyl)oxolan-3-yl]methanol |
| SMILES | CCCCCCCCc1ccc([C@@H]2C[C@@](CO)([N+](=O)[O-])CO2)cc1 |
| InChI | InChI=1S/C19H29NO4/c1-2-3-4-5-6-7-8-16-9-11-17(12-10-16)18-13-19(14-21,15-24-18)20(22)23/h9-12,18,21H,2-8,13-15H2,1H3/t18-,19-/m0/s1 |
| InChIKey | DUEUPXLTBJDURH-OALUTQOASA-N |
| XLogP | 4.06 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(3S,5S)-3-nitro-5-(4-octylphenyl)oxolan-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,5S)-3-nitro-5-(4-octylphenyl)oxolan-3-yl]methanol?
The IUPAC name of [(3S,5S)-3-nitro-5-(4-octylphenyl)oxolan-3-yl]methanol (CID 124562659) is [(3S,5S)-3-nitro-5-(4-octylphenyl)oxolan-3-yl]methanol.
What is the SMILES notation for [(3S,5S)-3-nitro-5-(4-octylphenyl)oxolan-3-yl]methanol?
The canonical SMILES for [(3S,5S)-3-nitro-5-(4-octylphenyl)oxolan-3-yl]methanol is CCCCCCCCc1ccc([C@@H]2C[C@@](CO)([N+](=O)[O-])CO2)cc1.
What is the InChIKey of [(3S,5S)-3-nitro-5-(4-octylphenyl)oxolan-3-yl]methanol?
The InChIKey is DUEUPXLTBJDURH-OALUTQOASA-N. The full InChI is InChI=1S/C19H29NO4/c1-2-3-4-5-6-7-8-16-9-11-17(12-10-16)18-13-19(14-21,15-24-18)20(22)23/h9-12,18,21H,2-8,13-15H2,1H3/t18-,19-/m0/s1.
What are the key properties of [(3S,5S)-3-nitro-5-(4-octylphenyl)oxolan-3-yl]methanol?
[(3S,5S)-3-nitro-5-(4-octylphenyl)oxolan-3-yl]methanol has a molecular weight of 335.44 g/mol, XLogP of 4.06, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,5S)-3-nitro-5-(4-octylphenyl)oxolan-3-yl]methanol is sourced from PubChem (CID 124562659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).