C22H36O3 — CID 123703893
1-(2,2-dimethyl-1,3-dioxan-5-yl)-2-(4-octylphenyl)ethanol (PubChem CID 123703893) has the molecular formula C22H36O3 and a molecular weight of 348.53 g/mol. Its IUPAC name is 1-(2,2-dimethyl-1,3-dioxan-5-yl)-2-(4-octylphenyl)ethanol.
| Compound Name | 1-(2,2-dimethyl-1,3-dioxan-5-yl)-2-(4-octylphenyl)ethanol |
|---|---|
| PubChem CID | 123703893 |
| Molecular Formula | C22H36O3 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.27 |
| IUPAC Name | 1-(2,2-dimethyl-1,3-dioxan-5-yl)-2-(4-octylphenyl)ethanol |
| SMILES | CCCCCCCCc1ccc(CC(O)C2COC(C)(C)OC2)cc1 |
| InChI | InChI=1S/C22H36O3/c1-4-5-6-7-8-9-10-18-11-13-19(14-12-18)15-21(23)20-16-24-22(2,3)25-17-20/h11-14,20-21,23H,4-10,15-17H2,1-3H3 |
| InChIKey | QFGGWPNUMVGWNM-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|