C19H30O6S — CID 91027665
2-[1-hydroxy-2-(4-nonylphenyl)ethoxy]-2-oxoethanesulfonic acid (PubChem CID 91027665) has the molecular formula C19H30O6S and a molecular weight of 386.51 g/mol. Its IUPAC name is 2-[1-hydroxy-2-(4-nonylphenyl)ethoxy]-2-oxoethanesulfonic acid.
| Compound Name | 2-[1-hydroxy-2-(4-nonylphenyl)ethoxy]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 91027665 |
| Molecular Formula | C19H30O6S |
| Molecular Weight | 386.51 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 2-[1-hydroxy-2-(4-nonylphenyl)ethoxy]-2-oxoethanesulfonic acid |
| SMILES | CCCCCCCCCc1ccc(CC(O)OC(=O)CS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C19H30O6S/c1-2-3-4-5-6-7-8-9-16-10-12-17(13-11-16)14-18(20)25-19(21)15-26(22,23)24/h10-13,18,20H,2-9,14-15H2,1H3,(H,22,23,24) |
| InChIKey | ASXMJHHEDUUNLD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.51 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|