About (4-heptylphenyl)borane
(4-heptylphenyl)borane (PubChem CID 123446258) has the molecular formula C13H21B
and a molecular weight of 188.12 g/mol. Its IUPAC name is (4-heptylphenyl)borane.
Molecular Properties
| Compound Name | (4-heptylphenyl)borane |
| PubChem CID | 123446258 |
| Molecular Formula | C13H21B |
| Molecular Weight | 188.12 g/mol |
| Exact Mass | 188.17 |
| IUPAC Name | (4-heptylphenyl)borane |
| SMILES | Bc1ccc(CCCCCCC)cc1 |
| InChI | InChI=1S/C13H21B/c1-2-3-4-5-6-7-12-8-10-13(14)11-9-12/h8-11H,2-7,14H2,1H3 |
| InChIKey | LXPPTRONOCIVDP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.12 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (4-heptylphenyl)borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-heptylphenyl)borane?
The IUPAC name of (4-heptylphenyl)borane (CID 123446258) is (4-heptylphenyl)borane.
What is the SMILES notation for (4-heptylphenyl)borane?
The canonical SMILES for (4-heptylphenyl)borane is Bc1ccc(CCCCCCC)cc1.
What is the InChIKey of (4-heptylphenyl)borane?
The InChIKey is LXPPTRONOCIVDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21B/c1-2-3-4-5-6-7-12-8-10-13(14)11-9-12/h8-11H,2-7,14H2,1H3.
What are the key properties of (4-heptylphenyl)borane?
(4-heptylphenyl)borane has a molecular weight of 188.12 g/mol, XLogP of 2.46, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (4-heptylphenyl)borane is sourced from PubChem (CID 123446258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).