C28H46O4 — CID 134255344
3,3,10-trimethyl-14-[(4-octylphenyl)methyl]-2,4,7,13-tetraoxaspiro[5.8]tetradecane (PubChem CID 134255344) has the molecular formula C28H46O4 and a molecular weight of 446.67 g/mol. Its IUPAC name is 3,3,10-trimethyl-14-[(4-octylphenyl)methyl]-2,4,7,13-tetraoxaspiro[5.8]tetradecane.
| Compound Name | 3,3,10-trimethyl-14-[(4-octylphenyl)methyl]-2,4,7,13-tetraoxaspiro[5.8]tetradecane |
|---|---|
| PubChem CID | 134255344 |
| Molecular Formula | C28H46O4 |
| Molecular Weight | 446.67 g/mol |
| Exact Mass | 446.34 |
| IUPAC Name | 3,3,10-trimethyl-14-[(4-octylphenyl)methyl]-2,4,7,13-tetraoxaspiro[5.8]tetradecane |
| SMILES | CCCCCCCCc1ccc(CC2OCCC(C)CCOC23COC(C)(C)OC3)cc1 |
| InChI | InChI=1S/C28H46O4/c1-5-6-7-8-9-10-11-24-12-14-25(15-13-24)20-26-28(21-31-27(3,4)32-22-28)30-19-17-23(2)16-18-29-26/h12-15,23,26H,5-11,16-22H2,1-4H3 |
| InChIKey | MEXZQXZFGJSJHA-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.67 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|