C22H37N — CID 59504295
cis-(1R,2S)-1-ethyl-2-[(4-octylphenyl)methyl]cyclopentan-1-amine (PubChem CID 59504295) has the molecular formula C22H37N and a molecular weight of 315.55 g/mol. Its IUPAC name is cis-(1R,2S)-1-ethyl-2-[(4-octylphenyl)methyl]cyclopentan-1-amine.
| Compound Name | cis-(1R,2S)-1-ethyl-2-[(4-octylphenyl)methyl]cyclopentan-1-amine |
|---|---|
| PubChem CID | 59504295 |
| Molecular Formula | C22H37N |
| Molecular Weight | 315.55 g/mol |
| Exact Mass | 315.29 |
| IUPAC Name | cis-(1R,2S)-1-ethyl-2-[(4-octylphenyl)methyl]cyclopentan-1-amine |
| SMILES | CCCCCCCCc1ccc(C[C@@H]2CCC[C@]2(N)CC)cc1 |
| InChI | InChI=1S/C22H37N/c1-3-5-6-7-8-9-11-19-13-15-20(16-14-19)18-21-12-10-17-22(21,23)4-2/h13-16,21H,3-12,17-18,23H2,1-2H3/t21-,22+/m0/s1 |
| InChIKey | UZWFXDHFGKKOGD-FCHUYYIVSA-N |
| XLogP | 6.04 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.55 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|