C20H33NO2 — CID 71018256
[(1S,2R)-1-amino-2-[(4-heptoxyphenyl)methyl]cyclopentyl]methanol (PubChem CID 71018256) has the molecular formula C20H33NO2 and a molecular weight of 319.49 g/mol. Its IUPAC name is [(1S,2R)-1-amino-2-[(4-heptoxyphenyl)methyl]cyclopentyl]methanol.
| Compound Name | [(1S,2R)-1-amino-2-[(4-heptoxyphenyl)methyl]cyclopentyl]methanol |
|---|---|
| PubChem CID | 71018256 |
| Molecular Formula | C20H33NO2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | [(1S,2R)-1-amino-2-[(4-heptoxyphenyl)methyl]cyclopentyl]methanol |
| SMILES | CCCCCCCOc1ccc(C[C@H]2CCC[C@@]2(N)CO)cc1 |
| InChI | InChI=1S/C20H33NO2/c1-2-3-4-5-6-14-23-19-11-9-17(10-12-19)15-18-8-7-13-20(18,21)16-22/h9-12,18,22H,2-8,13-16,21H2,1H3/t18-,20-/m1/s1 |
| InChIKey | KBNYREUBNRVSSW-UYAOXDASSA-N |
| XLogP | 4.07 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|