C20H34NO2+ — CID 163701678
[(1R,2R)-1-amino-2-[(4-heptoxyphenyl)methyl]cyclopentyl]methyloxidanium (PubChem CID 163701678) has the molecular formula C20H34NO2+ and a molecular weight of 320.50 g/mol. Its IUPAC name is [(1R,2R)-1-amino-2-[(4-heptoxyphenyl)methyl]cyclopentyl]methyloxidanium.
| Compound Name | [(1R,2R)-1-amino-2-[(4-heptoxyphenyl)methyl]cyclopentyl]methyloxidanium |
|---|---|
| PubChem CID | 163701678 |
| Molecular Formula | C20H34NO2+ |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.26 |
| IUPAC Name | [(1R,2R)-1-amino-2-[(4-heptoxyphenyl)methyl]cyclopentyl]methyloxidanium |
| SMILES | CCCCCCCOc1ccc(C[C@H]2CCC[C@]2(N)C[OH2+])cc1 |
| InChI | InChI=1S/C20H33NO2/c1-2-3-4-5-6-14-23-19-11-9-17(10-12-19)15-18-8-7-13-20(18,21)16-22/h9-12,18,22H,2-8,13-16,21H2,1H3/p+1/t18-,20+/m1/s1 |
| InChIKey | KBNYREUBNRVSSW-QUCCMNQESA-O |
| XLogP | 3.80 |
| TPSA | 58.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|