C6F10O — CID 139601556
3,3,4,5-tetrafluoro-2,2-bis(trifluoromethyl)furan (PubChem CID 139601556) has the molecular formula C6F10O and a molecular weight of 278.05 g/mol. Its IUPAC name is 3,3,4,5-tetrafluoro-2,2-bis(trifluoromethyl)furan.
| Compound Name | 3,3,4,5-tetrafluoro-2,2-bis(trifluoromethyl)furan |
|---|---|
| PubChem CID | 139601556 |
| Molecular Formula | C6F10O |
| Molecular Weight | 278.05 g/mol |
| Exact Mass | 277.98 |
| IUPAC Name | 3,3,4,5-tetrafluoro-2,2-bis(trifluoromethyl)furan |
| SMILES | FC1=C(F)C(F)(F)C(C(F)(F)F)(C(F)(F)F)O1 |
| InChI | InChI=1S/C6F10O/c7-1-2(8)17-4(3(1,9)10,5(11,12)13)6(14,15)16 |
| InChIKey | QPPKFGUSLXWSDY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.05 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |