C8F12O4 — CID 88907706
2,3,6,6,8,10-hexafluoro-8,10-bis(trifluoromethyl)-1,4,7,9-tetraoxaspiro[4.5]dec-2-ene (PubChem CID 88907706) has the molecular formula C8F12O4 and a molecular weight of 388.06 g/mol. Its IUPAC name is 2,3,6,6,8,10-hexafluoro-8,10-bis(trifluoromethyl)-1,4,7,9-tetraoxaspiro[4.5]dec-2-ene.
| Compound Name | 2,3,6,6,8,10-hexafluoro-8,10-bis(trifluoromethyl)-1,4,7,9-tetraoxaspiro[4.5]dec-2-ene |
|---|---|
| PubChem CID | 88907706 |
| Molecular Formula | C8F12O4 |
| Molecular Weight | 388.06 g/mol |
| Exact Mass | 387.96 |
| IUPAC Name | 2,3,6,6,8,10-hexafluoro-8,10-bis(trifluoromethyl)-1,4,7,9-tetraoxaspiro[4.5]dec-2-ene |
| SMILES | FC1=C(F)OC2(O1)C(F)(F)OC(F)(C(F)(F)F)OC2(F)C(F)(F)F |
| InChI | InChI=1S/C8F12O4/c9-1-2(10)22-4(21-1)3(11,5(12,13)14)23-8(20,6(15,16)17)24-7(4,18)19 |
| InChIKey | SGUPSKJFHAEWSV-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.06 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |