About 2,2,3,5-tetrafluoro-3-(trifluoromethyl)-1,4-dioxine
2,2,3,5-tetrafluoro-3-(trifluoromethyl)-1,4-dioxine (PubChem CID 89318758) has the molecular formula C5HF7O2
and a molecular weight of 226.05 g/mol. Its IUPAC name is 2,2,3,5-tetrafluoro-3-(trifluoromethyl)-1,4-dioxine.
Analyze 2,2,3,5-tetrafluoro-3-(trifluoromethyl)-1,4-dioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,3,5-tetrafluoro-3-(trifluoromethyl)-1,4-dioxine?
The IUPAC name of 2,2,3,5-tetrafluoro-3-(trifluoromethyl)-1,4-dioxine (CID 89318758) is 2,2,3,5-tetrafluoro-3-(trifluoromethyl)-1,4-dioxine.
What is the SMILES notation for 2,2,3,5-tetrafluoro-3-(trifluoromethyl)-1,4-dioxine?
The canonical SMILES for 2,2,3,5-tetrafluoro-3-(trifluoromethyl)-1,4-dioxine is FC1=COC(F)(F)C(F)(C(F)(F)F)O1.
What is the InChIKey of 2,2,3,5-tetrafluoro-3-(trifluoromethyl)-1,4-dioxine?
The InChIKey is GRZSYBCBPUXSRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5HF7O2/c6-2-1-13-5(11,12)3(7,14-2)4(8,9)10/h1H.
What are the key properties of 2,2,3,5-tetrafluoro-3-(trifluoromethyl)-1,4-dioxine?
2,2,3,5-tetrafluoro-3-(trifluoromethyl)-1,4-dioxine has a molecular weight of 226.05 g/mol, XLogP of 2.62, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,3,5-tetrafluoro-3-(trifluoromethyl)-1,4-dioxine is sourced from PubChem (CID 89318758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).