C5Cl2F8O — CID 101028523
(2R,3R)-2,3-dichloro-2,3-difluoro-4,4-bis(trifluoromethyl)oxetane (PubChem CID 101028523) has the molecular formula C5Cl2F8O and a molecular weight of 298.94 g/mol. Its IUPAC name is (2R,3R)-2,3-dichloro-2,3-difluoro-4,4-bis(trifluoromethyl)oxetane.
| Compound Name | (2R,3R)-2,3-dichloro-2,3-difluoro-4,4-bis(trifluoromethyl)oxetane |
|---|---|
| PubChem CID | 101028523 |
| Molecular Formula | C5Cl2F8O |
| Molecular Weight | 298.94 g/mol |
| Exact Mass | 297.92 |
| IUPAC Name | (2R,3R)-2,3-dichloro-2,3-difluoro-4,4-bis(trifluoromethyl)oxetane |
| SMILES | FC(F)(F)C1(C(F)(F)F)O[C@](F)(Cl)[C@]1(F)Cl |
| InChI | InChI=1S/C5Cl2F8O/c6-2(8)1(4(10,11)12,5(13,14)15)16-3(2,7)9/t2-,3-/m0/s1 |
| InChIKey | LAYFPAJNHTZJDD-HRFVKAFMSA-N |
| XLogP | 3.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.94 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|