C14H18ClF12O2P — CID 12501804
2,2-ditert-butyl-2-chloro-4,4,5,5-tetrakis(trifluoromethyl)-1,3,2lambda5-dioxaphospholane (PubChem CID 12501804) has the molecular formula C14H18ClF12O2P and a molecular weight of 512.70 g/mol. Its IUPAC name is 2,2-ditert-butyl-2-chloro-4,4,5,5-tetrakis(trifluoromethyl)-1,3,2lambda5-dioxaphospholane.
| Compound Name | 2,2-ditert-butyl-2-chloro-4,4,5,5-tetrakis(trifluoromethyl)-1,3,2lambda5-dioxaphospholane |
|---|---|
| PubChem CID | 12501804 |
| Molecular Formula | C14H18ClF12O2P |
| Molecular Weight | 512.70 g/mol |
| Exact Mass | 512.05 |
| IUPAC Name | 2,2-ditert-butyl-2-chloro-4,4,5,5-tetrakis(trifluoromethyl)-1,3,2lambda5-dioxaphospholane |
| SMILES | CC(C)(C)P1(Cl)(C(C)(C)C)OC(C(F)(F)F)(C(F)(F)F)C(C(F)(F)F)(C(F)(F)F)O1 |
| InChI | InChI=1S/C14H18ClF12O2P/c1-7(2,3)30(15,8(4,5)6)28-9(11(16,17)18,12(19,20)21)10(29-30,13(22,23)24)14(25,26)27/h1-6H3 |
| InChIKey | SZZSCFPWFUTYCR-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.70 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|