C6H8F7OP — CID 23417169
2-fluoro-2,2-dimethyl-4,4-bis(trifluoromethyl)-1,2λ5-oxaphosphetane (PubChem CID 23417169) has the molecular formula C6H8F7OP and a molecular weight of 260.09 g/mol. Its IUPAC name is 2-fluoro-2,2-dimethyl-4,4-bis(trifluoromethyl)-1,2λ5-oxaphosphetane.
| Compound Name | 2-fluoro-2,2-dimethyl-4,4-bis(trifluoromethyl)-1,2λ5-oxaphosphetane |
|---|---|
| PubChem CID | 23417169 |
| Molecular Formula | C6H8F7OP |
| Molecular Weight | 260.09 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | 2-fluoro-2,2-dimethyl-4,4-bis(trifluoromethyl)-1,2λ5-oxaphosphetane |
| SMILES | CP1(C)(F)CC(C(F)(F)F)(C(F)(F)F)O1 |
| InChI | InChI=1S/C6H8F7OP/c1-15(2,13)3-4(14-15,5(7,8)9)6(10,11)12/h3H2,1-2H3 |
| InChIKey | RJEWXHBOJJIPGJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.09 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|