C5H3F7O — CID 14144890
4-fluoro-2,2-bis(trifluoromethyl)oxetane (PubChem CID 14144890) has the molecular formula C5H3F7O and a molecular weight of 212.06 g/mol. Its IUPAC name is 4-fluoro-2,2-bis(trifluoromethyl)oxetane.
| Compound Name | 4-fluoro-2,2-bis(trifluoromethyl)oxetane |
|---|---|
| PubChem CID | 14144890 |
| Molecular Formula | C5H3F7O |
| Molecular Weight | 212.06 g/mol |
| Exact Mass | 212.01 |
| IUPAC Name | 4-fluoro-2,2-bis(trifluoromethyl)oxetane |
| SMILES | FC1CC(C(F)(F)F)(C(F)(F)F)O1 |
| InChI | InChI=1S/C5H3F7O/c6-2-1-3(13-2,4(7,8)9)5(10,11)12/h2H,1H2 |
| InChIKey | WYTQJAIQMKQJAF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.06 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |