C7H8F6O — CID 59459127
(3R)-3-propan-2-yl-2,2-bis(trifluoromethyl)oxirane (PubChem CID 59459127) has the molecular formula C7H8F6O and a molecular weight of 222.13 g/mol. Its IUPAC name is (3R)-3-propan-2-yl-2,2-bis(trifluoromethyl)oxirane.
| Compound Name | (3R)-3-propan-2-yl-2,2-bis(trifluoromethyl)oxirane |
|---|---|
| PubChem CID | 59459127 |
| Molecular Formula | C7H8F6O |
| Molecular Weight | 222.13 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | (3R)-3-propan-2-yl-2,2-bis(trifluoromethyl)oxirane |
| SMILES | CC(C)[C@H]1OC1(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H8F6O/c1-3(2)4-5(14-4,6(8,9)10)7(11,12)13/h3-4H,1-2H3/t4-/m1/s1 |
| InChIKey | DJTGJKZQHOKOJR-SCSAIBSYSA-N |
| XLogP | 2.90 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.13 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|