C11H11F13O — CID 19761962
1,1,1,2,2,3,3,5,5,5-decafluoro-4-(3-methylbutoxy)-4-(trifluoromethyl)pentane (PubChem CID 19761962) has the molecular formula C11H11F13O and a molecular weight of 406.18 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,5,5,5-decafluoro-4-(3-methylbutoxy)-4-(trifluoromethyl)pentane.
| Compound Name | 1,1,1,2,2,3,3,5,5,5-decafluoro-4-(3-methylbutoxy)-4-(trifluoromethyl)pentane |
|---|---|
| PubChem CID | 19761962 |
| Molecular Formula | C11H11F13O |
| Molecular Weight | 406.18 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | 1,1,1,2,2,3,3,5,5,5-decafluoro-4-(3-methylbutoxy)-4-(trifluoromethyl)pentane |
| SMILES | CC(C)CCOC(C(F)(F)F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H11F13O/c1-5(2)3-4-25-6(9(16,17)18,10(19,20)21)7(12,13)8(14,15)11(22,23)24/h5H,3-4H2,1-2H3 |
| InChIKey | TUGUFMZLYPXKMT-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.18 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|