C11H14F10O — CID 19761941
1,1,1,2,2,3,3,5,5,5-decafluoro-4-methyl-4-(3-methylbutoxy)pentane (PubChem CID 19761941) has the molecular formula C11H14F10O and a molecular weight of 352.21 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,5,5,5-decafluoro-4-methyl-4-(3-methylbutoxy)pentane.
| Compound Name | 1,1,1,2,2,3,3,5,5,5-decafluoro-4-methyl-4-(3-methylbutoxy)pentane |
|---|---|
| PubChem CID | 19761941 |
| Molecular Formula | C11H14F10O |
| Molecular Weight | 352.21 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 1,1,1,2,2,3,3,5,5,5-decafluoro-4-methyl-4-(3-methylbutoxy)pentane |
| SMILES | CC(C)CCOC(C)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H14F10O/c1-6(2)4-5-22-7(3,10(16,17)18)8(12,13)9(14,15)11(19,20)21/h6H,4-5H2,1-3H3 |
| InChIKey | PXBZMGVICNGRRO-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.21 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|