C13H17F12N4O2P — CID 23418093
6-methyl-5-pyrrolidin-1-yl-2,2,3,3-tetrakis(trifluoromethyl)-1,4-dioxa-6,9-diaza-5λ5-phosphaspiro[4.4]nonan-9-amine (PubChem CID 23418093) has the molecular formula C13H17F12N4O2P and a molecular weight of 520.26 g/mol. Its IUPAC name is 6-methyl-5-pyrrolidin-1-yl-2,2,3,3-tetrakis(trifluoromethyl)-1,4-dioxa-6,9-diaza-5λ5-phosphaspiro[4.4]nonan-9-amine.
| Compound Name | 6-methyl-5-pyrrolidin-1-yl-2,2,3,3-tetrakis(trifluoromethyl)-1,4-dioxa-6,9-diaza-5λ5-phosphaspiro[4.4]nonan-9-amine |
|---|---|
| PubChem CID | 23418093 |
| Molecular Formula | C13H17F12N4O2P |
| Molecular Weight | 520.26 g/mol |
| Exact Mass | 520.09 |
| IUPAC Name | 6-methyl-5-pyrrolidin-1-yl-2,2,3,3-tetrakis(trifluoromethyl)-1,4-dioxa-6,9-diaza-5λ5-phosphaspiro[4.4]nonan-9-amine |
| SMILES | CN1CCN(N)P12(N1CCCC1)OC(C(F)(F)F)(C(F)(F)F)C(C(F)(F)F)(C(F)(F)F)O2 |
| InChI | InChI=1S/C13H17F12N4O2P/c1-27-6-7-29(26)32(27,28-4-2-3-5-28)30-8(10(14,15)16,11(17,18)19)9(31-32,12(20,21)22)13(23,24)25/h2-7,26H2,1H3 |
| InChIKey | VHYAJDPSJJIXOL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 54.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.26 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|