C15H21F12O5PSi — CID 14022721
trimethyl-[[7,7,8,8-tetramethyl-2,2,3,3-tetrakis(trifluoromethyl)-1,4,6,9-tetraoxa-5lambda5-phosphaspiro[4.4]nonan-5-yl]oxy]silane (PubChem CID 14022721) has the molecular formula C15H21F12O5PSi and a molecular weight of 568.36 g/mol. Its IUPAC name is trimethyl-[[7,7,8,8-tetramethyl-2,2,3,3-tetrakis(trifluoromethyl)-1,4,6,9-tetraoxa-5lambda5-phosphaspiro[4.4]nonan-5-yl]oxy]silane.
| Compound Name | trimethyl-[[7,7,8,8-tetramethyl-2,2,3,3-tetrakis(trifluoromethyl)-1,4,6,9-tetraoxa-5lambda5-phosphaspiro[4.4]nonan-5-yl]oxy]silane |
|---|---|
| PubChem CID | 14022721 |
| Molecular Formula | C15H21F12O5PSi |
| Molecular Weight | 568.36 g/mol |
| Exact Mass | 568.07 |
| IUPAC Name | trimethyl-[[7,7,8,8-tetramethyl-2,2,3,3-tetrakis(trifluoromethyl)-1,4,6,9-tetraoxa-5lambda5-phosphaspiro[4.4]nonan-5-yl]oxy]silane |
| SMILES | CC1(C)OP2(O[Si](C)(C)C)(OC1(C)C)OC(C(F)(F)F)(C(F)(F)F)C(C(F)(F)F)(C(F)(F)F)O2 |
| InChI | InChI=1S/C15H21F12O5PSi/c1-8(2)9(3,4)29-33(28-8,32-34(5,6)7)30-10(12(16,17)18,13(19,20)21)11(31-33,14(22,23)24)15(25,26)27/h1-7H3 |
| InChIKey | WBBOGHQCRJYZLO-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.36 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|