C12H18F12O2Si2 — CID 121002323
[1,1,1,4,4,4-hexafluoro-2,3-bis(trifluoromethyl)-3-trimethylsilyloxybutan-2-yl]oxy-trimethylsilane (PubChem CID 121002323) has the molecular formula C12H18F12O2Si2 and a molecular weight of 478.42 g/mol. Its IUPAC name is [1,1,1,4,4,4-hexafluoro-2,3-bis(trifluoromethyl)-3-trimethylsilyloxybutan-2-yl]oxy-trimethylsilane.
| Compound Name | [1,1,1,4,4,4-hexafluoro-2,3-bis(trifluoromethyl)-3-trimethylsilyloxybutan-2-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 121002323 |
| Molecular Formula | C12H18F12O2Si2 |
| Molecular Weight | 478.42 g/mol |
| Exact Mass | 478.07 |
| IUPAC Name | [1,1,1,4,4,4-hexafluoro-2,3-bis(trifluoromethyl)-3-trimethylsilyloxybutan-2-yl]oxy-trimethylsilane |
| SMILES | C[Si](C)(C)OC(C(F)(F)F)(C(F)(F)F)C(O[Si](C)(C)C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H18F12O2Si2/c1-27(2,3)25-7(9(13,14)15,10(16,17)18)8(11(19,20)21,12(22,23)24)26-28(4,5)6/h1-6H3 |
| InChIKey | FZUHICKKVJTAFE-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.42 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|