C12H12AlF15O3 — CID 158068577
[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-bis[(1,1,1-trifluoro-2-methylpropan-2-yl)oxy]alumane (PubChem CID 158068577) has the molecular formula C12H12AlF15O3 and a molecular weight of 516.18 g/mol. Its IUPAC name is [1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-bis[(1,1,1-trifluoro-2-methylpropan-2-yl)oxy]alumane.
| Compound Name | [1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-bis[(1,1,1-trifluoro-2-methylpropan-2-yl)oxy]alumane |
|---|---|
| PubChem CID | 158068577 |
| Molecular Formula | C12H12AlF15O3 |
| Molecular Weight | 516.18 g/mol |
| Exact Mass | 516.04 |
| IUPAC Name | [1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-bis[(1,1,1-trifluoro-2-methylpropan-2-yl)oxy]alumane |
| SMILES | CC(C)(O[Al](OC(C)(C)C(F)(F)F)OC(C(F)(F)F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C4F9O.2C4H6F3O.Al/c5-2(6,7)1(14,3(8,9)10)4(11,12)13;2*1-3(2,8)4(5,6)7;/h;2*1-2H3;/q3*-1;+3 |
| InChIKey | OTYYQYRHJQYKQF-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.18 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |