C12H15F9O4 — CID 160602540
(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl) acetate;(1,1,1-trifluoro-2-methylpropan-2-yl) acetate (PubChem CID 160602540) has the molecular formula C12H15F9O4 and a molecular weight of 394.23 g/mol. Its IUPAC name is (1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl) acetate;(1,1,1-trifluoro-2-methylpropan-2-yl) acetate.
| Compound Name | (1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl) acetate;(1,1,1-trifluoro-2-methylpropan-2-yl) acetate |
|---|---|
| PubChem CID | 160602540 |
| Molecular Formula | C12H15F9O4 |
| Molecular Weight | 394.23 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | (1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl) acetate;(1,1,1-trifluoro-2-methylpropan-2-yl) acetate |
| SMILES | CC(=O)OC(C)(C(F)(F)F)C(F)(F)F.CC(=O)OC(C)(C)C(F)(F)F |
| InChI | InChI=1S/C6H6F6O2.C6H9F3O2/c1-3(13)14-4(2,5(7,8)9)6(10,11)12;1-4(10)11-5(2,3)6(7,8)9/h1-2H3;1-3H3 |
| InChIKey | RELWWIGXORFOQU-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.23 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |