C6H12O5S3 — CID 141193584
[1,1,1-trihydroxy-2-methyl-3,3,3-tris(sulfanyl)propan-2-yl] acetate (PubChem CID 141193584) has the molecular formula C6H12O5S3 and a molecular weight of 260.36 g/mol. Its IUPAC name is [1,1,1-trihydroxy-2-methyl-3,3,3-tris(sulfanyl)propan-2-yl] acetate.
| Compound Name | [1,1,1-trihydroxy-2-methyl-3,3,3-tris(sulfanyl)propan-2-yl] acetate |
|---|---|
| PubChem CID | 141193584 |
| Molecular Formula | C6H12O5S3 |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 259.98 |
| IUPAC Name | [1,1,1-trihydroxy-2-methyl-3,3,3-tris(sulfanyl)propan-2-yl] acetate |
| SMILES | CC(=O)OC(C)(C(O)(O)O)C(S)(S)S |
| InChI | InChI=1S/C6H12O5S3/c1-3(7)11-4(2,5(8,9)10)6(12,13)14/h8-10,12-14H,1-2H3 |
| InChIKey | HSRCIYKQSCOORW-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|