C6H6F6O4 — CID 157217399
trifluoromethoxy (1,1,1-trifluoro-2-methylpropan-2-yl) carbonate (PubChem CID 157217399) has the molecular formula C6H6F6O4 and a molecular weight of 256.10 g/mol. Its IUPAC name is trifluoromethoxy (1,1,1-trifluoro-2-methylpropan-2-yl) carbonate.
| Compound Name | trifluoromethoxy (1,1,1-trifluoro-2-methylpropan-2-yl) carbonate |
|---|---|
| PubChem CID | 157217399 |
| Molecular Formula | C6H6F6O4 |
| Molecular Weight | 256.10 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | trifluoromethoxy (1,1,1-trifluoro-2-methylpropan-2-yl) carbonate |
| SMILES | CC(C)(OC(=O)OOC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H6F6O4/c1-4(2,5(7,8)9)14-3(13)15-16-6(10,11)12/h1-2H3 |
| InChIKey | GETGNBKUSLNMCI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.10 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|