C5H4F6O4 — CID 143284330
(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl) ethaneperoxoate (PubChem CID 143284330) has the molecular formula C5H4F6O4 and a molecular weight of 242.07 g/mol. Its IUPAC name is (1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl) ethaneperoxoate.
| Compound Name | (1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl) ethaneperoxoate |
|---|---|
| PubChem CID | 143284330 |
| Molecular Formula | C5H4F6O4 |
| Molecular Weight | 242.07 g/mol |
| Exact Mass | 242.00 |
| IUPAC Name | (1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl) ethaneperoxoate |
| SMILES | CC(=O)OOC(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H4F6O4/c1-2(12)14-15-3(13,4(6,7)8)5(9,10)11/h13H,1H3 |
| InChIKey | YMZPGPCBAXCYIK-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.07 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|