About bis(3-hydroxy-2,3-dimethylbutan-2-yl) carbonate
bis(3-hydroxy-2,3-dimethylbutan-2-yl) carbonate (PubChem CID 118293174) has the molecular formula C13H26O5
and a molecular weight of 262.35 g/mol. Its IUPAC name is bis(3-hydroxy-2,3-dimethylbutan-2-yl) carbonate.
Molecular Properties
| Compound Name | bis(3-hydroxy-2,3-dimethylbutan-2-yl) carbonate |
| PubChem CID | 118293174 |
| Molecular Formula | C13H26O5 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | bis(3-hydroxy-2,3-dimethylbutan-2-yl) carbonate |
| SMILES | CC(C)(O)C(C)(C)OC(=O)OC(C)(C)C(C)(C)O |
| InChI | InChI=1S/C13H26O5/c1-10(2,15)12(5,6)17-9(14)18-13(7,8)11(3,4)16/h15-16H,1-8H3 |
| InChIKey | OVKFGYXPVHSOKR-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze bis(3-hydroxy-2,3-dimethylbutan-2-yl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-hydroxy-2,3-dimethylbutan-2-yl) carbonate?
The IUPAC name of bis(3-hydroxy-2,3-dimethylbutan-2-yl) carbonate (CID 118293174) is bis(3-hydroxy-2,3-dimethylbutan-2-yl) carbonate.
What is the SMILES notation for bis(3-hydroxy-2,3-dimethylbutan-2-yl) carbonate?
The canonical SMILES for bis(3-hydroxy-2,3-dimethylbutan-2-yl) carbonate is CC(C)(O)C(C)(C)OC(=O)OC(C)(C)C(C)(C)O.
What is the InChIKey of bis(3-hydroxy-2,3-dimethylbutan-2-yl) carbonate?
The InChIKey is OVKFGYXPVHSOKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O5/c1-10(2,15)12(5,6)17-9(14)18-13(7,8)11(3,4)16/h15-16H,1-8H3.
What are the key properties of bis(3-hydroxy-2,3-dimethylbutan-2-yl) carbonate?
bis(3-hydroxy-2,3-dimethylbutan-2-yl) carbonate has a molecular weight of 262.35 g/mol, XLogP of 2.24, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-hydroxy-2,3-dimethylbutan-2-yl) carbonate is sourced from PubChem (CID 118293174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).