About bis(2-ethoxypropan-2-yl) carbonate
bis(2-ethoxypropan-2-yl) carbonate (PubChem CID 87247770) has the molecular formula C11H22O5
and a molecular weight of 234.29 g/mol. Its IUPAC name is bis(2-ethoxypropan-2-yl) carbonate.
Molecular Properties
| Compound Name | bis(2-ethoxypropan-2-yl) carbonate |
| PubChem CID | 87247770 |
| Molecular Formula | C11H22O5 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | bis(2-ethoxypropan-2-yl) carbonate |
| SMILES | CCOC(C)(C)OC(=O)OC(C)(C)OCC |
| InChI | InChI=1S/C11H22O5/c1-7-13-10(3,4)15-9(12)16-11(5,6)14-8-2/h7-8H2,1-6H3 |
| InChIKey | XWFQMSXOVSPISN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze bis(2-ethoxypropan-2-yl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-ethoxypropan-2-yl) carbonate?
The IUPAC name of bis(2-ethoxypropan-2-yl) carbonate (CID 87247770) is bis(2-ethoxypropan-2-yl) carbonate.
What is the SMILES notation for bis(2-ethoxypropan-2-yl) carbonate?
The canonical SMILES for bis(2-ethoxypropan-2-yl) carbonate is CCOC(C)(C)OC(=O)OC(C)(C)OCC.
What is the InChIKey of bis(2-ethoxypropan-2-yl) carbonate?
The InChIKey is XWFQMSXOVSPISN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O5/c1-7-13-10(3,4)15-9(12)16-11(5,6)14-8-2/h7-8H2,1-6H3.
What are the key properties of bis(2-ethoxypropan-2-yl) carbonate?
bis(2-ethoxypropan-2-yl) carbonate has a molecular weight of 234.29 g/mol, XLogP of 2.68, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-ethoxypropan-2-yl) carbonate is sourced from PubChem (CID 87247770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).