C10H21NO5 — CID 134443036
(3-hydroxy-2,3-dimethylbutan-2-yl) 2-(hydroxyamino)oxy-2-methylpropanoate (PubChem CID 134443036) has the molecular formula C10H21NO5 and a molecular weight of 235.28 g/mol. Its IUPAC name is (3-hydroxy-2,3-dimethylbutan-2-yl) 2-(hydroxyamino)oxy-2-methylpropanoate.
| Compound Name | (3-hydroxy-2,3-dimethylbutan-2-yl) 2-(hydroxyamino)oxy-2-methylpropanoate |
|---|---|
| PubChem CID | 134443036 |
| Molecular Formula | C10H21NO5 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | (3-hydroxy-2,3-dimethylbutan-2-yl) 2-(hydroxyamino)oxy-2-methylpropanoate |
| SMILES | CC(C)(ONO)C(=O)OC(C)(C)C(C)(C)O |
| InChI | InChI=1S/C10H21NO5/c1-8(2,16-11-14)7(12)15-10(5,6)9(3,4)13/h11,13-14H,1-6H3 |
| InChIKey | YTBRBAJRZWHQBO-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|