C16H32O3S — CID 154930692
2,3,3-trimethylpentan-2-yl 2-tert-butylsulfanyloxy-2-methylpropanoate (PubChem CID 154930692) has the molecular formula C16H32O3S and a molecular weight of 304.50 g/mol. Its IUPAC name is 2,3,3-trimethylpentan-2-yl 2-tert-butylsulfanyloxy-2-methylpropanoate.
| Compound Name | 2,3,3-trimethylpentan-2-yl 2-tert-butylsulfanyloxy-2-methylpropanoate |
|---|---|
| PubChem CID | 154930692 |
| Molecular Formula | C16H32O3S |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.21 |
| IUPAC Name | 2,3,3-trimethylpentan-2-yl 2-tert-butylsulfanyloxy-2-methylpropanoate |
| SMILES | CCC(C)(C)C(C)(C)OC(=O)C(C)(C)OSC(C)(C)C |
| InChI | InChI=1S/C16H32O3S/c1-11-14(5,6)16(9,10)18-12(17)15(7,8)19-20-13(2,3)4/h11H2,1-10H3 |
| InChIKey | TUKYXUSNPHSKEX-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|