C7H4F12O2 — CID 12603900
1,1,1,4,4,4-hexafluoro-3-methoxy-2,3-bis(trifluoromethyl)butan-2-ol (PubChem CID 12603900) has the molecular formula C7H4F12O2 and a molecular weight of 348.08 g/mol. Its IUPAC name is 1,1,1,4,4,4-hexafluoro-3-methoxy-2,3-bis(trifluoromethyl)butan-2-ol.
| Compound Name | 1,1,1,4,4,4-hexafluoro-3-methoxy-2,3-bis(trifluoromethyl)butan-2-ol |
|---|---|
| PubChem CID | 12603900 |
| Molecular Formula | C7H4F12O2 |
| Molecular Weight | 348.08 g/mol |
| Exact Mass | 348.00 |
| IUPAC Name | 1,1,1,4,4,4-hexafluoro-3-methoxy-2,3-bis(trifluoromethyl)butan-2-ol |
| SMILES | COC(C(F)(F)F)(C(F)(F)F)C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H4F12O2/c1-21-3(6(14,15)16,7(17,18)19)2(20,4(8,9)10)5(11,12)13/h20H,1H3 |
| InChIKey | VWXURONXTKZHSR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.08 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |