C7H11F9O2SiZn — CID 87619953
1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-ol;hydroxy(trimethyl)silane;zinc (PubChem CID 87619953) has the molecular formula C7H11F9O2SiZn and a molecular weight of 391.62 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-ol;hydroxy(trimethyl)silane;zinc.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-ol;hydroxy(trimethyl)silane;zinc |
|---|---|
| PubChem CID | 87619953 |
| Molecular Formula | C7H11F9O2SiZn |
| Molecular Weight | 391.62 g/mol |
| Exact Mass | 389.97 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-ol;hydroxy(trimethyl)silane;zinc |
| SMILES | C[Si](C)(C)O.OC(C(F)(F)F)(C(F)(F)F)C(F)(F)F.[Zn] |
| InChI | InChI=1S/C4HF9O.C3H10OSi.Zn/c5-2(6,7)1(14,3(8,9)10)4(11,12)13;1-5(2,3)4;/h14H;4H,1-3H3; |
| InChIKey | VYBSPGSIEGENST-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.62 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|