About bis(hydroxy(trimethyl)silane);titanium
bis(hydroxy(trimethyl)silane);titanium (PubChem CID 140547958) has the molecular formula C6H20O2Si2Ti
and a molecular weight of 228.26 g/mol. Its IUPAC name is bis(hydroxy(trimethyl)silane);titanium.
Molecular Properties
| Compound Name | bis(hydroxy(trimethyl)silane);titanium |
| PubChem CID | 140547958 |
| Molecular Formula | C6H20O2Si2Ti |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | bis(hydroxy(trimethyl)silane);titanium |
| SMILES | C[Si](C)(C)O.C[Si](C)(C)O.[Ti] |
| InChI | InChI=1S/2C3H10OSi.Ti/c2*1-5(2,3)4;/h2*4H,1-3H3; |
| InChIKey | UVUXLELITMLVTD-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(hydroxy(trimethyl)silane);titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(hydroxy(trimethyl)silane);titanium?
The IUPAC name of bis(hydroxy(trimethyl)silane);titanium (CID 140547958) is bis(hydroxy(trimethyl)silane);titanium.
What is the SMILES notation for bis(hydroxy(trimethyl)silane);titanium?
The canonical SMILES for bis(hydroxy(trimethyl)silane);titanium is C[Si](C)(C)O.C[Si](C)(C)O.[Ti].
What is the InChIKey of bis(hydroxy(trimethyl)silane);titanium?
The InChIKey is UVUXLELITMLVTD-UHFFFAOYSA-N. The full InChI is InChI=1S/2C3H10OSi.Ti/c2*1-5(2,3)4;/h2*4H,1-3H3;.
What are the key properties of bis(hydroxy(trimethyl)silane);titanium?
bis(hydroxy(trimethyl)silane);titanium has a molecular weight of 228.26 g/mol, XLogP of 1.62, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(hydroxy(trimethyl)silane);titanium is sourced from PubChem (CID 140547958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).