C12H32O2Si3 — CID 157357994
ethenyl-hydroxy-dimethylsilane;ethenyl(trimethyl)silane;hydroxy(trimethyl)silane (PubChem CID 157357994) has the molecular formula C12H32O2Si3 and a molecular weight of 292.64 g/mol. Its IUPAC name is ethenyl-hydroxy-dimethylsilane;ethenyl(trimethyl)silane;hydroxy(trimethyl)silane.
| Compound Name | ethenyl-hydroxy-dimethylsilane;ethenyl(trimethyl)silane;hydroxy(trimethyl)silane |
|---|---|
| PubChem CID | 157357994 |
| Molecular Formula | C12H32O2Si3 |
| Molecular Weight | 292.64 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | ethenyl-hydroxy-dimethylsilane;ethenyl(trimethyl)silane;hydroxy(trimethyl)silane |
| SMILES | C=C[Si](C)(C)C.C=C[Si](C)(C)O.C[Si](C)(C)O |
| InChI | InChI=1S/C5H12Si.C4H10OSi.C3H10OSi/c1-5-6(2,3)4;1-4-6(2,3)5;1-5(2,3)4/h5H,1H2,2-4H3;4-5H,1H2,2-3H3;4H,1-3H3 |
| InChIKey | BIHUSDOGXBAACT-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.64 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|