About dimethylsilane;ethenyl(trimethyl)silane;trimethylsilane
dimethylsilane;ethenyl(trimethyl)silane;trimethylsilane (PubChem CID 158896373) has the molecular formula C10H30Si3
and a molecular weight of 234.61 g/mol. Its IUPAC name is dimethylsilane;ethenyl(trimethyl)silane;trimethylsilane.
Molecular Properties
| Compound Name | dimethylsilane;ethenyl(trimethyl)silane;trimethylsilane |
| PubChem CID | 158896373 |
| Molecular Formula | C10H30Si3 |
| Molecular Weight | 234.61 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | dimethylsilane;ethenyl(trimethyl)silane;trimethylsilane |
| SMILES | C=C[Si](C)(C)C.C[SiH2]C.C[SiH](C)C |
| InChI | InChI=1S/C5H12Si.C3H10Si.C2H8Si/c1-5-6(2,3)4;1-4(2)3;1-3-2/h5H,1H2,2-4H3;4H,1-3H3;3H2,1-2H3 |
| InChIKey | JEWNUGFNAODQDL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.61 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethylsilane;ethenyl(trimethyl)silane;trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylsilane;ethenyl(trimethyl)silane;trimethylsilane?
The IUPAC name of dimethylsilane;ethenyl(trimethyl)silane;trimethylsilane (CID 158896373) is dimethylsilane;ethenyl(trimethyl)silane;trimethylsilane.
What is the SMILES notation for dimethylsilane;ethenyl(trimethyl)silane;trimethylsilane?
The canonical SMILES for dimethylsilane;ethenyl(trimethyl)silane;trimethylsilane is C=C[Si](C)(C)C.C[SiH2]C.C[SiH](C)C.
What is the InChIKey of dimethylsilane;ethenyl(trimethyl)silane;trimethylsilane?
The InChIKey is JEWNUGFNAODQDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12Si.C3H10Si.C2H8Si/c1-5-6(2,3)4;1-4(2)3;1-3-2/h5H,1H2,2-4H3;4H,1-3H3;3H2,1-2H3.
What are the key properties of dimethylsilane;ethenyl(trimethyl)silane;trimethylsilane?
dimethylsilane;ethenyl(trimethyl)silane;trimethylsilane has a molecular weight of 234.61 g/mol, XLogP of 3.40, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylsilane;ethenyl(trimethyl)silane;trimethylsilane is sourced from PubChem (CID 158896373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).